C22H28Cl2N4O2S — CID 90158245
N-methoxy-5-[3-(2-piperidin-4-yl-1,3-thiazol-4-yl)-4,5-dihydro-1,2-oxazol-5-yl]-3,4-dihydro-2H-naphthalen-1-imine;dihydrochloride (PubChem CID 90158245) has the molecular formula C22H28Cl2N4O2S and a molecular weight of 483.47 g/mol. Its IUPAC name is N-methoxy-5-[3-(2-piperidin-4-yl-1,3-thiazol-4-yl)-4,5-dihydro-1,2-oxazol-5-yl]-3,4-dihydro-2H-naphthalen-1-imine;dihydrochloride.
| Compound Name | N-methoxy-5-[3-(2-piperidin-4-yl-1,3-thiazol-4-yl)-4,5-dihydro-1,2-oxazol-5-yl]-3,4-dihydro-2H-naphthalen-1-imine;dihydrochloride |
|---|---|
| PubChem CID | 90158245 |
| Molecular Formula | C22H28Cl2N4O2S |
| Molecular Weight | 483.47 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | N-methoxy-5-[3-(2-piperidin-4-yl-1,3-thiazol-4-yl)-4,5-dihydro-1,2-oxazol-5-yl]-3,4-dihydro-2H-naphthalen-1-imine;dihydrochloride |
| SMILES | CON=C1CCCc2c1cccc2C1CC(c2csc(C3CCNCC3)n2)=NO1.Cl.Cl |
| InChI | InChI=1S/C22H26N4O2S.2ClH/c1-27-25-18-7-3-4-15-16(18)5-2-6-17(15)21-12-19(26-28-21)20-13-29-22(24-20)14-8-10-23-11-9-14;;/h2,5-6,13-14,21,23H,3-4,7-12H2,1H3;2*1H |
| InChIKey | OBSRHQVHSBKNGJ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.47 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|