C25H47NO7Si — CID 90158461
tert-butyl 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-6-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 90158461) has the molecular formula C25H47NO7Si and a molecular weight of 501.74 g/mol. Its IUPAC name is tert-butyl 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-6-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-6-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 90158461 |
| Molecular Formula | C25H47NO7Si |
| Molecular Weight | 501.74 g/mol |
| Exact Mass | 501.31 |
| IUPAC Name | tert-butyl 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-6-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)CC1C2OC(C)(C)OC2C(CO[Si](C)(C)C(C)(C)C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H47NO7Si/c1-22(2,3)30-18(27)14-16-19-20(32-25(10,11)31-19)17(15-29-34(12,13)24(7,8)9)26(16)21(28)33-23(4,5)6/h16-17,19-20H,14-15H2,1-13H3 |
| InChIKey | GAYNFCIFGKCZPL-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.74 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|