About 8-methoxycarbonyl-1,4-dioxa-7-azaspiro[4.4]nonane-7-carboxylic acid
8-methoxycarbonyl-1,4-dioxa-7-azaspiro[4.4]nonane-7-carboxylic acid (PubChem CID 90158552) has the molecular formula C9H13NO6
and a molecular weight of 231.20 g/mol. Its IUPAC name is 8-methoxycarbonyl-1,4-dioxa-7-azaspiro[4.4]nonane-7-carboxylic acid.
Molecular Properties
| Compound Name | 8-methoxycarbonyl-1,4-dioxa-7-azaspiro[4.4]nonane-7-carboxylic acid |
| PubChem CID | 90158552 |
| Molecular Formula | C9H13NO6 |
| Molecular Weight | 231.20 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 8-methoxycarbonyl-1,4-dioxa-7-azaspiro[4.4]nonane-7-carboxylic acid |
| SMILES | COC(=O)C1CC2(CN1C(=O)O)OCCO2 |
| InChI | InChI=1S/C9H13NO6/c1-14-7(11)6-4-9(15-2-3-16-9)5-10(6)8(12)13/h6H,2-5H2,1H3,(H,12,13) |
| InChIKey | ZYUJQSDISLZPEW-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.20 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-methoxycarbonyl-1,4-dioxa-7-azaspiro[4.4]nonane-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxycarbonyl-1,4-dioxa-7-azaspiro[4.4]nonane-7-carboxylic acid?
The IUPAC name of 8-methoxycarbonyl-1,4-dioxa-7-azaspiro[4.4]nonane-7-carboxylic acid (CID 90158552) is 8-methoxycarbonyl-1,4-dioxa-7-azaspiro[4.4]nonane-7-carboxylic acid.
What is the SMILES notation for 8-methoxycarbonyl-1,4-dioxa-7-azaspiro[4.4]nonane-7-carboxylic acid?
The canonical SMILES for 8-methoxycarbonyl-1,4-dioxa-7-azaspiro[4.4]nonane-7-carboxylic acid is COC(=O)C1CC2(CN1C(=O)O)OCCO2.
What is the InChIKey of 8-methoxycarbonyl-1,4-dioxa-7-azaspiro[4.4]nonane-7-carboxylic acid?
The InChIKey is ZYUJQSDISLZPEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO6/c1-14-7(11)6-4-9(15-2-3-16-9)5-10(6)8(12)13/h6H,2-5H2,1H3,(H,12,13).
What are the key properties of 8-methoxycarbonyl-1,4-dioxa-7-azaspiro[4.4]nonane-7-carboxylic acid?
8-methoxycarbonyl-1,4-dioxa-7-azaspiro[4.4]nonane-7-carboxylic acid has a molecular weight of 231.20 g/mol, XLogP of -0.35, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxycarbonyl-1,4-dioxa-7-azaspiro[4.4]nonane-7-carboxylic acid is sourced from PubChem (CID 90158552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).