C16H18Cl2N6 — CID 90159585
4-[2-[(3,4-dichlorophenyl)methyl]-2-propylhydrazinyl]-N-prop-2-ynyl-1,3,5-triazin-2-amine (PubChem CID 90159585) has the molecular formula C16H18Cl2N6 and a molecular weight of 365.27 g/mol. Its IUPAC name is 4-[2-[(3,4-dichlorophenyl)methyl]-2-propylhydrazinyl]-N-prop-2-ynyl-1,3,5-triazin-2-amine.
| Compound Name | 4-[2-[(3,4-dichlorophenyl)methyl]-2-propylhydrazinyl]-N-prop-2-ynyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 90159585 |
| Molecular Formula | C16H18Cl2N6 |
| Molecular Weight | 365.27 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 4-[2-[(3,4-dichlorophenyl)methyl]-2-propylhydrazinyl]-N-prop-2-ynyl-1,3,5-triazin-2-amine |
| SMILES | C#CCNc1ncnc(NN(CCC)Cc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C16H18Cl2N6/c1-3-7-19-15-20-11-21-16(22-15)23-24(8-4-2)10-12-5-6-13(17)14(18)9-12/h1,5-6,9,11H,4,7-8,10H2,2H3,(H2,19,20,21,22,23) |
| InChIKey | BIZWOYKHCWLSGB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.27 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|