C24H48N4O3 — CID 90159636
N-[1-(2-aminoethylamino)-1-oxohexan-2-yl]-2-(octanoylamino)octanamide (PubChem CID 90159636) has the molecular formula C24H48N4O3 and a molecular weight of 440.67 g/mol. Its IUPAC name is N-[1-(2-aminoethylamino)-1-oxohexan-2-yl]-2-(octanoylamino)octanamide.
| Compound Name | N-[1-(2-aminoethylamino)-1-oxohexan-2-yl]-2-(octanoylamino)octanamide |
|---|---|
| PubChem CID | 90159636 |
| Molecular Formula | C24H48N4O3 |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 440.37 |
| IUPAC Name | N-[1-(2-aminoethylamino)-1-oxohexan-2-yl]-2-(octanoylamino)octanamide |
| SMILES | CCCCCCCC(=O)NC(CCCCCC)C(=O)NC(CCCC)C(=O)NCCN |
| InChI | InChI=1S/C24H48N4O3/c1-4-7-10-12-14-17-22(29)27-21(16-13-11-8-5-2)24(31)28-20(15-9-6-3)23(30)26-19-18-25/h20-21H,4-19,25H2,1-3H3,(H,26,30)(H,27,29)(H,28,31) |
| InChIKey | AXSNLWKJZGCRIB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|