C43H76O9 — CID 90159657
2-[(9Z,28Z)-19-[(1S)-1,2-dihydroxyethyl]-18,20-dioxoheptatriaconta-9,28-dien-19-yl]oxybutanedioic acid (PubChem CID 90159657) has the molecular formula C43H76O9 and a molecular weight of 737.07 g/mol. Its IUPAC name is 2-[(9Z,28Z)-19-[(1S)-1,2-dihydroxyethyl]-18,20-dioxoheptatriaconta-9,28-dien-19-yl]oxybutanedioic acid.
| Compound Name | 2-[(9Z,28Z)-19-[(1S)-1,2-dihydroxyethyl]-18,20-dioxoheptatriaconta-9,28-dien-19-yl]oxybutanedioic acid |
|---|---|
| PubChem CID | 90159657 |
| Molecular Formula | C43H76O9 |
| Molecular Weight | 737.07 g/mol |
| Exact Mass | 736.55 |
| IUPAC Name | 2-[(9Z,28Z)-19-[(1S)-1,2-dihydroxyethyl]-18,20-dioxoheptatriaconta-9,28-dien-19-yl]oxybutanedioic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)C(OC(CC(=O)O)C(=O)O)(C(=O)CCCCCCC/C=C\CCCCCCCC)[C@@H](O)CO |
| InChI | InChI=1S/C43H76O9/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38(45)43(40(47)36-44,52-37(42(50)51)35-41(48)49)39(46)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,37,40,44,47H,3-16,21-36H2,1-2H3,(H,48,49)(H,50,51)/b19-17-,20-18-/t37?,40-/m0/s1 |
| InChIKey | HBRNEHAKXMVHFY-PMKIQNHDSA-N |
| XLogP | 10.24 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.07 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|