C11H14N2 — CID 90160209
2,3,4,8-tetrahydro-1H-benzo[7]annulen-1-yldiazene (PubChem CID 90160209) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 2,3,4,8-tetrahydro-1H-benzo[7]annulen-1-yldiazene.
| Compound Name | 2,3,4,8-tetrahydro-1H-benzo[7]annulen-1-yldiazene |
|---|---|
| PubChem CID | 90160209 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 2,3,4,8-tetrahydro-1H-benzo[7]annulen-1-yldiazene |
| SMILES | [H]/N=N/C1CCCC2=CC=CCC=C21 |
| InChI | InChI=1S/C11H14N2/c12-13-11-8-4-6-9-5-2-1-3-7-10(9)11/h1-2,5,7,11-12H,3-4,6,8H2/b13-12+ |
| InChIKey | SWXRXKRZLFIBCS-OUKQBFOZSA-N |
| XLogP | 3.38 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|