C27H35N3O6 — CID 90160267
(4R,6S,9S,16E)-6-acetyl-9-propan-2-yl-3,12-dioxa-1,7,10-triazatetracyclo[20.3.1.14,7.018,23]heptacosa-16,18,20,22-tetraene-2,8,11-trione (PubChem CID 90160267) has the molecular formula C27H35N3O6 and a molecular weight of 497.59 g/mol. Its IUPAC name is (4R,6S,9S,16E)-6-acetyl-9-propan-2-yl-3,12-dioxa-1,7,10-triazatetracyclo[20.3.1.14,7.018,23]heptacosa-16,18,20,22-tetraene-2,8,11-trione.
| Compound Name | (4R,6S,9S,16E)-6-acetyl-9-propan-2-yl-3,12-dioxa-1,7,10-triazatetracyclo[20.3.1.14,7.018,23]heptacosa-16,18,20,22-tetraene-2,8,11-trione |
|---|---|
| PubChem CID | 90160267 |
| Molecular Formula | C27H35N3O6 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.25 |
| IUPAC Name | (4R,6S,9S,16E)-6-acetyl-9-propan-2-yl-3,12-dioxa-1,7,10-triazatetracyclo[20.3.1.14,7.018,23]heptacosa-16,18,20,22-tetraene-2,8,11-trione |
| SMILES | CC(=O)[C@@H]1C[C@@H]2CN1C(=O)[C@H](C(C)C)NC(=O)OCCC/C=C/c1cccc3c1CCN(C3)C(=O)O2 |
| InChI | InChI=1S/C27H35N3O6/c1-17(2)24-25(32)30-16-21(14-23(30)18(3)31)36-27(34)29-12-11-22-19(9-7-10-20(22)15-29)8-5-4-6-13-35-26(33)28-24/h5,7-10,17,21,23-24H,4,6,11-16H2,1-3H3,(H,28,33)/b8-5+/t21-,23+,24+/m1/s1 |
| InChIKey | SFQBRJLYSUMUFQ-FFWBBPJXSA-N |
| XLogP | 3.30 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |