C19H19N5O3S — CID 9016056
N-[(Z)-1-[4-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)phenyl]ethylideneamino]-3-nitrobenzamide (PubChem CID 9016056) has the molecular formula C19H19N5O3S and a molecular weight of 397.46 g/mol. Its IUPAC name is N-[(Z)-1-[4-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)phenyl]ethylideneamino]-3-nitrobenzamide.
| Compound Name | N-[(Z)-1-[4-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)phenyl]ethylideneamino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 9016056 |
| Molecular Formula | C19H19N5O3S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | N-[(Z)-1-[4-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)phenyl]ethylideneamino]-3-nitrobenzamide |
| SMILES | C/C(=N/NC(=O)c1cccc([N+](=O)[O-])c1)c1ccc(NC2=NCCCS2)cc1 |
| InChI | InChI=1S/C19H19N5O3S/c1-13(22-23-18(25)15-4-2-5-17(12-15)24(26)27)14-6-8-16(9-7-14)21-19-20-10-3-11-28-19/h2,4-9,12H,3,10-11H2,1H3,(H,20,21)(H,23,25)/b22-13- |
| InChIKey | KEZBUWUZYBCFEC-XKZIYDEJSA-N |
| XLogP | 3.65 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|