About 4-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)butanal
4-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)butanal (PubChem CID 90160737) has the molecular formula C8H9FN2O3
and a molecular weight of 200.17 g/mol. Its IUPAC name is 4-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)butanal.
Molecular Properties
| Compound Name | 4-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)butanal |
| PubChem CID | 90160737 |
| Molecular Formula | C8H9FN2O3 |
| Molecular Weight | 200.17 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 4-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)butanal |
| SMILES | O=CCCCn1c(=O)[nH]cc(F)c1=O |
| InChI | InChI=1S/C8H9FN2O3/c9-6-5-10-8(14)11(7(6)13)3-1-2-4-12/h4-5H,1-3H2,(H,10,14) |
| InChIKey | MQARUUYZXUIMGA-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.17 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)butanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)butanal?
The IUPAC name of 4-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)butanal (CID 90160737) is 4-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)butanal.
What is the SMILES notation for 4-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)butanal?
The canonical SMILES for 4-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)butanal is O=CCCCn1c(=O)[nH]cc(F)c1=O.
What is the InChIKey of 4-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)butanal?
The InChIKey is MQARUUYZXUIMGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9FN2O3/c9-6-5-10-8(14)11(7(6)13)3-1-2-4-12/h4-5H,1-3H2,(H,10,14).
What are the key properties of 4-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)butanal?
4-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)butanal has a molecular weight of 200.17 g/mol, XLogP of -0.35, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)butanal is sourced from PubChem (CID 90160737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).