C30H34N2 — CID 90160739
9-[(Z)-5-(4a,4b,8a,9a-tetrahydrocarbazol-9-yl)hex-2-enyl]-3,4,4b,8a-tetrahydrocarbazole (PubChem CID 90160739) has the molecular formula C30H34N2 and a molecular weight of 422.62 g/mol. Its IUPAC name is 9-[(Z)-5-(4a,4b,8a,9a-tetrahydrocarbazol-9-yl)hex-2-enyl]-3,4,4b,8a-tetrahydrocarbazole.
| Compound Name | 9-[(Z)-5-(4a,4b,8a,9a-tetrahydrocarbazol-9-yl)hex-2-enyl]-3,4,4b,8a-tetrahydrocarbazole |
|---|---|
| PubChem CID | 90160739 |
| Molecular Formula | C30H34N2 |
| Molecular Weight | 422.62 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 9-[(Z)-5-(4a,4b,8a,9a-tetrahydrocarbazol-9-yl)hex-2-enyl]-3,4,4b,8a-tetrahydrocarbazole |
| SMILES | CC(C/C=C\CN1C2=C(CCC=C2)C2C=CC=CC21)N1C2C=CC=CC2C2C=CC=CC21 |
| InChI | InChI=1S/C30H34N2/c1-22(32-29-19-8-4-15-25(29)26-16-5-9-20-30(26)32)12-10-11-21-31-27-17-6-2-13-23(27)24-14-3-7-18-28(24)31/h2,4-11,13,15-20,22-23,25-27,29-30H,3,12,14,21H2,1H3/b11-10- |
| InChIKey | QNQJFHLZWRZUQU-KHPPLWFESA-N |
| XLogP | 5.89 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.62 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|