C12H17NO4S — CID 90160783
[(4S)-3,4,5,6-tetrahydro-1H-2,5-benzoxazocin-4-yl]methyl methanesulfonate (PubChem CID 90160783) has the molecular formula C12H17NO4S and a molecular weight of 271.34 g/mol. Its IUPAC name is [(4S)-3,4,5,6-tetrahydro-1H-2,5-benzoxazocin-4-yl]methyl methanesulfonate.
| Compound Name | [(4S)-3,4,5,6-tetrahydro-1H-2,5-benzoxazocin-4-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 90160783 |
| Molecular Formula | C12H17NO4S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | [(4S)-3,4,5,6-tetrahydro-1H-2,5-benzoxazocin-4-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@@H]1COCc2ccccc2CN1 |
| InChI | InChI=1S/C12H17NO4S/c1-18(14,15)17-9-12-8-16-7-11-5-3-2-4-10(11)6-13-12/h2-5,12-13H,6-9H2,1H3/t12-/m0/s1 |
| InChIKey | BRUFGZOQSCSYKH-LBPRGKRZSA-N |
| XLogP | 0.65 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|