About 4,4-difluoro-1-propan-2-yl-3-(trifluoromethyl)-6,7-dihydro-5H-indazole
4,4-difluoro-1-propan-2-yl-3-(trifluoromethyl)-6,7-dihydro-5H-indazole (PubChem CID 90162048) has the molecular formula C11H13F5N2
and a molecular weight of 268.23 g/mol. Its IUPAC name is 4,4-difluoro-1-propan-2-yl-3-(trifluoromethyl)-6,7-dihydro-5H-indazole.
Molecular Properties
| Compound Name | 4,4-difluoro-1-propan-2-yl-3-(trifluoromethyl)-6,7-dihydro-5H-indazole |
| PubChem CID | 90162048 |
| Molecular Formula | C11H13F5N2 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 4,4-difluoro-1-propan-2-yl-3-(trifluoromethyl)-6,7-dihydro-5H-indazole |
| SMILES | CC(C)n1nc(C(F)(F)F)c2c1CCCC2(F)F |
| InChI | InChI=1S/C11H13F5N2/c1-6(2)18-7-4-3-5-10(12,13)8(7)9(17-18)11(14,15)16/h6H,3-5H2,1-2H3 |
| InChIKey | XLGUIJQDBWOVPP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,4-difluoro-1-propan-2-yl-3-(trifluoromethyl)-6,7-dihydro-5H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluoro-1-propan-2-yl-3-(trifluoromethyl)-6,7-dihydro-5H-indazole?
The IUPAC name of 4,4-difluoro-1-propan-2-yl-3-(trifluoromethyl)-6,7-dihydro-5H-indazole (CID 90162048) is 4,4-difluoro-1-propan-2-yl-3-(trifluoromethyl)-6,7-dihydro-5H-indazole.
What is the SMILES notation for 4,4-difluoro-1-propan-2-yl-3-(trifluoromethyl)-6,7-dihydro-5H-indazole?
The canonical SMILES for 4,4-difluoro-1-propan-2-yl-3-(trifluoromethyl)-6,7-dihydro-5H-indazole is CC(C)n1nc(C(F)(F)F)c2c1CCCC2(F)F.
What is the InChIKey of 4,4-difluoro-1-propan-2-yl-3-(trifluoromethyl)-6,7-dihydro-5H-indazole?
The InChIKey is XLGUIJQDBWOVPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F5N2/c1-6(2)18-7-4-3-5-10(12,13)8(7)9(17-18)11(14,15)16/h6H,3-5H2,1-2H3.
What are the key properties of 4,4-difluoro-1-propan-2-yl-3-(trifluoromethyl)-6,7-dihydro-5H-indazole?
4,4-difluoro-1-propan-2-yl-3-(trifluoromethyl)-6,7-dihydro-5H-indazole has a molecular weight of 268.23 g/mol, XLogP of 3.91, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluoro-1-propan-2-yl-3-(trifluoromethyl)-6,7-dihydro-5H-indazole is sourced from PubChem (CID 90162048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).