About 5-cyclopentyl-3-(1,1-difluoroethyl)-1-propan-2-ylpyrazole
5-cyclopentyl-3-(1,1-difluoroethyl)-1-propan-2-ylpyrazole (PubChem CID 90162078) has the molecular formula C13H20F2N2
and a molecular weight of 242.31 g/mol. Its IUPAC name is 5-cyclopentyl-3-(1,1-difluoroethyl)-1-propan-2-ylpyrazole.
Molecular Properties
| Compound Name | 5-cyclopentyl-3-(1,1-difluoroethyl)-1-propan-2-ylpyrazole |
| PubChem CID | 90162078 |
| Molecular Formula | C13H20F2N2 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 5-cyclopentyl-3-(1,1-difluoroethyl)-1-propan-2-ylpyrazole |
| SMILES | CC(C)n1nc(C(C)(F)F)cc1C1CCCC1 |
| InChI | InChI=1S/C13H20F2N2/c1-9(2)17-11(10-6-4-5-7-10)8-12(16-17)13(3,14)15/h8-10H,4-7H2,1-3H3 |
| InChIKey | GVZGQTLAYAQZLO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-cyclopentyl-3-(1,1-difluoroethyl)-1-propan-2-ylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopentyl-3-(1,1-difluoroethyl)-1-propan-2-ylpyrazole?
The IUPAC name of 5-cyclopentyl-3-(1,1-difluoroethyl)-1-propan-2-ylpyrazole (CID 90162078) is 5-cyclopentyl-3-(1,1-difluoroethyl)-1-propan-2-ylpyrazole.
What is the SMILES notation for 5-cyclopentyl-3-(1,1-difluoroethyl)-1-propan-2-ylpyrazole?
The canonical SMILES for 5-cyclopentyl-3-(1,1-difluoroethyl)-1-propan-2-ylpyrazole is CC(C)n1nc(C(C)(F)F)cc1C1CCCC1.
What is the InChIKey of 5-cyclopentyl-3-(1,1-difluoroethyl)-1-propan-2-ylpyrazole?
The InChIKey is GVZGQTLAYAQZLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20F2N2/c1-9(2)17-11(10-6-4-5-7-10)8-12(16-17)13(3,14)15/h8-10H,4-7H2,1-3H3.
What are the key properties of 5-cyclopentyl-3-(1,1-difluoroethyl)-1-propan-2-ylpyrazole?
5-cyclopentyl-3-(1,1-difluoroethyl)-1-propan-2-ylpyrazole has a molecular weight of 242.31 g/mol, XLogP of 4.23, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopentyl-3-(1,1-difluoroethyl)-1-propan-2-ylpyrazole is sourced from PubChem (CID 90162078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).