About 3-(difluoromethyl)-7,7-dimethyl-1-propan-2-yl-5,6-dihydro-4H-indazole
3-(difluoromethyl)-7,7-dimethyl-1-propan-2-yl-5,6-dihydro-4H-indazole (PubChem CID 90162172) has the molecular formula C13H20F2N2
and a molecular weight of 242.31 g/mol. Its IUPAC name is 3-(difluoromethyl)-7,7-dimethyl-1-propan-2-yl-5,6-dihydro-4H-indazole.
Molecular Properties
| Compound Name | 3-(difluoromethyl)-7,7-dimethyl-1-propan-2-yl-5,6-dihydro-4H-indazole |
| PubChem CID | 90162172 |
| Molecular Formula | C13H20F2N2 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 3-(difluoromethyl)-7,7-dimethyl-1-propan-2-yl-5,6-dihydro-4H-indazole |
| SMILES | CC(C)n1nc(C(F)F)c2c1C(C)(C)CCC2 |
| InChI | InChI=1S/C13H20F2N2/c1-8(2)17-11-9(10(16-17)12(14)15)6-5-7-13(11,3)4/h8,12H,5-7H2,1-4H3 |
| InChIKey | XOPJRSZOQZBPIJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(difluoromethyl)-7,7-dimethyl-1-propan-2-yl-5,6-dihydro-4H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(difluoromethyl)-7,7-dimethyl-1-propan-2-yl-5,6-dihydro-4H-indazole?
The IUPAC name of 3-(difluoromethyl)-7,7-dimethyl-1-propan-2-yl-5,6-dihydro-4H-indazole (CID 90162172) is 3-(difluoromethyl)-7,7-dimethyl-1-propan-2-yl-5,6-dihydro-4H-indazole.
What is the SMILES notation for 3-(difluoromethyl)-7,7-dimethyl-1-propan-2-yl-5,6-dihydro-4H-indazole?
The canonical SMILES for 3-(difluoromethyl)-7,7-dimethyl-1-propan-2-yl-5,6-dihydro-4H-indazole is CC(C)n1nc(C(F)F)c2c1C(C)(C)CCC2.
What is the InChIKey of 3-(difluoromethyl)-7,7-dimethyl-1-propan-2-yl-5,6-dihydro-4H-indazole?
The InChIKey is XOPJRSZOQZBPIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20F2N2/c1-8(2)17-11-9(10(16-17)12(14)15)6-5-7-13(11,3)4/h8,12H,5-7H2,1-4H3.
What are the key properties of 3-(difluoromethyl)-7,7-dimethyl-1-propan-2-yl-5,6-dihydro-4H-indazole?
3-(difluoromethyl)-7,7-dimethyl-1-propan-2-yl-5,6-dihydro-4H-indazole has a molecular weight of 242.31 g/mol, XLogP of 4.02, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(difluoromethyl)-7,7-dimethyl-1-propan-2-yl-5,6-dihydro-4H-indazole is sourced from PubChem (CID 90162172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).