C34H31F3N4O4 — CID 90162400
ethyl 3-[(4R)-4-[3-(3-carbamoyl-4-fluorophenyl)-2-pyridinyl]-5-(3,5-difluorophenyl)-2-oxopentyl]-3,4-diazatricyclo[6.1.1.02,6]deca-2(6),4-diene-5-carboxylate (PubChem CID 90162400) has the molecular formula C34H31F3N4O4 and a molecular weight of 616.64 g/mol. Its IUPAC name is ethyl 3-[(4R)-4-[3-(3-carbamoyl-4-fluorophenyl)-2-pyridinyl]-5-(3,5-difluorophenyl)-2-oxopentyl]-3,4-diazatricyclo[6.1.1.02,6]deca-2(6),4-diene-5-carboxylate.
| Compound Name | ethyl 3-[(4R)-4-[3-(3-carbamoyl-4-fluorophenyl)-2-pyridinyl]-5-(3,5-difluorophenyl)-2-oxopentyl]-3,4-diazatricyclo[6.1.1.02,6]deca-2(6),4-diene-5-carboxylate |
|---|---|
| PubChem CID | 90162400 |
| Molecular Formula | C34H31F3N4O4 |
| Molecular Weight | 616.64 g/mol |
| Exact Mass | 616.23 |
| IUPAC Name | ethyl 3-[(4R)-4-[3-(3-carbamoyl-4-fluorophenyl)-2-pyridinyl]-5-(3,5-difluorophenyl)-2-oxopentyl]-3,4-diazatricyclo[6.1.1.02,6]deca-2(6),4-diene-5-carboxylate |
| SMILES | CCOC(=O)c1nn(CC(=O)C[C@@H](Cc2cc(F)cc(F)c2)c2ncccc2-c2ccc(F)c(C(N)=O)c2)c2c1CC1CC2C1 |
| InChI | InChI=1S/C34H31F3N4O4/c1-2-45-34(44)31-28-13-18-9-22(10-18)32(28)41(40-31)17-25(42)14-21(8-19-11-23(35)16-24(36)12-19)30-26(4-3-7-39-30)20-5-6-29(37)27(15-20)33(38)43/h3-7,11-12,15-16,18,21-22H,2,8-10,13-14,17H2,1H3,(H2,38,43)/t18?,21-,22?/m1/s1 |
| InChIKey | GTUYDLLWGLLYKV-NFOQDIRWSA-N |
| XLogP | 5.67 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.64 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |