About 4-(1,1-difluoroethyl)-1-propan-2-yl-2-(trifluoromethyl)imidazole
4-(1,1-difluoroethyl)-1-propan-2-yl-2-(trifluoromethyl)imidazole (PubChem CID 90162785) has the molecular formula C9H11F5N2
and a molecular weight of 242.19 g/mol. Its IUPAC name is 4-(1,1-difluoroethyl)-1-propan-2-yl-2-(trifluoromethyl)imidazole.
Molecular Properties
| Compound Name | 4-(1,1-difluoroethyl)-1-propan-2-yl-2-(trifluoromethyl)imidazole |
| PubChem CID | 90162785 |
| Molecular Formula | C9H11F5N2 |
| Molecular Weight | 242.19 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 4-(1,1-difluoroethyl)-1-propan-2-yl-2-(trifluoromethyl)imidazole |
| SMILES | CC(C)n1cc(C(C)(F)F)nc1C(F)(F)F |
| InChI | InChI=1S/C9H11F5N2/c1-5(2)16-4-6(8(3,10)11)15-7(16)9(12,13)14/h4-5H,1-3H3 |
| InChIKey | SRVCQONJJJVYHX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.19 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(1,1-difluoroethyl)-1-propan-2-yl-2-(trifluoromethyl)imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,1-difluoroethyl)-1-propan-2-yl-2-(trifluoromethyl)imidazole?
The IUPAC name of 4-(1,1-difluoroethyl)-1-propan-2-yl-2-(trifluoromethyl)imidazole (CID 90162785) is 4-(1,1-difluoroethyl)-1-propan-2-yl-2-(trifluoromethyl)imidazole.
What is the SMILES notation for 4-(1,1-difluoroethyl)-1-propan-2-yl-2-(trifluoromethyl)imidazole?
The canonical SMILES for 4-(1,1-difluoroethyl)-1-propan-2-yl-2-(trifluoromethyl)imidazole is CC(C)n1cc(C(C)(F)F)nc1C(F)(F)F.
What is the InChIKey of 4-(1,1-difluoroethyl)-1-propan-2-yl-2-(trifluoromethyl)imidazole?
The InChIKey is SRVCQONJJJVYHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F5N2/c1-5(2)16-4-6(8(3,10)11)15-7(16)9(12,13)14/h4-5H,1-3H3.
What are the key properties of 4-(1,1-difluoroethyl)-1-propan-2-yl-2-(trifluoromethyl)imidazole?
4-(1,1-difluoroethyl)-1-propan-2-yl-2-(trifluoromethyl)imidazole has a molecular weight of 242.19 g/mol, XLogP of 3.59, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,1-difluoroethyl)-1-propan-2-yl-2-(trifluoromethyl)imidazole is sourced from PubChem (CID 90162785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).