C35H31F3N4O2 — CID 90162808
5-[2-[(1S)-2-(3,5-difluorophenyl)-1-[[2-(1,2,3,4-tetrahydrocarbazol-9-yl)acetyl]amino]ethyl]-3-pyridinyl]-2-fluoro-N-methylbenzamide (PubChem CID 90162808) has the molecular formula C35H31F3N4O2 and a molecular weight of 596.65 g/mol. Its IUPAC name is 5-[2-[(1S)-2-(3,5-difluorophenyl)-1-[[2-(1,2,3,4-tetrahydrocarbazol-9-yl)acetyl]amino]ethyl]-3-pyridinyl]-2-fluoro-N-methylbenzamide.
| Compound Name | 5-[2-[(1S)-2-(3,5-difluorophenyl)-1-[[2-(1,2,3,4-tetrahydrocarbazol-9-yl)acetyl]amino]ethyl]-3-pyridinyl]-2-fluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 90162808 |
| Molecular Formula | C35H31F3N4O2 |
| Molecular Weight | 596.65 g/mol |
| Exact Mass | 596.24 |
| IUPAC Name | 5-[2-[(1S)-2-(3,5-difluorophenyl)-1-[[2-(1,2,3,4-tetrahydrocarbazol-9-yl)acetyl]amino]ethyl]-3-pyridinyl]-2-fluoro-N-methylbenzamide |
| SMILES | CNC(=O)c1cc(-c2cccnc2[C@H](Cc2cc(F)cc(F)c2)NC(=O)Cn2c3c(c4ccccc42)CCCC3)ccc1F |
| InChI | InChI=1S/C35H31F3N4O2/c1-39-35(44)28-18-22(12-13-29(28)38)25-9-6-14-40-34(25)30(17-21-15-23(36)19-24(37)16-21)41-33(43)20-42-31-10-4-2-7-26(31)27-8-3-5-11-32(27)42/h2,4,6-7,9-10,12-16,18-19,30H,3,5,8,11,17,20H2,1H3,(H,39,44)(H,41,43)/t30-/m0/s1 |
| InChIKey | WIEAKQFALXXQFA-PMERELPUSA-N |
| XLogP | 6.46 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.65 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|