C30H33F3N4O4 — CID 90163063
1-[4-(6-methylnaphthalen-2-yl)piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone (PubChem CID 90163063) has the molecular formula C30H33F3N4O4 and a molecular weight of 570.61 g/mol. Its IUPAC name is 1-[4-(6-methylnaphthalen-2-yl)piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone.
| Compound Name | 1-[4-(6-methylnaphthalen-2-yl)piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone |
|---|---|
| PubChem CID | 90163063 |
| Molecular Formula | C30H33F3N4O4 |
| Molecular Weight | 570.61 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | 1-[4-(6-methylnaphthalen-2-yl)piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone |
| SMILES | Cc1ccc2cc(N3CCN(C(=O)COC4CCC(Nc5ccc([N+](=O)[O-])c(C(F)(F)F)c5)CC4)CC3)ccc2c1 |
| InChI | InChI=1S/C30H33F3N4O4/c1-20-2-3-22-17-25(8-4-21(22)16-20)35-12-14-36(15-13-35)29(38)19-41-26-9-5-23(6-10-26)34-24-7-11-28(37(39)40)27(18-24)30(31,32)33/h2-4,7-8,11,16-18,23,26,34H,5-6,9-10,12-15,19H2,1H3 |
| InChIKey | NBMIIMHATJXUCO-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.61 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|