C33H39F3N4O4 — CID 90163070
1-[(3S,5R)-3,5-dimethyl-4-[(6-methylnaphthalen-2-yl)methyl]piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone (PubChem CID 90163070) has the molecular formula C33H39F3N4O4 and a molecular weight of 612.69 g/mol. Its IUPAC name is 1-[(3S,5R)-3,5-dimethyl-4-[(6-methylnaphthalen-2-yl)methyl]piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone.
| Compound Name | 1-[(3S,5R)-3,5-dimethyl-4-[(6-methylnaphthalen-2-yl)methyl]piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone |
|---|---|
| PubChem CID | 90163070 |
| Molecular Formula | C33H39F3N4O4 |
| Molecular Weight | 612.69 g/mol |
| Exact Mass | 612.29 |
| IUPAC Name | 1-[(3S,5R)-3,5-dimethyl-4-[(6-methylnaphthalen-2-yl)methyl]piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone |
| SMILES | Cc1ccc2cc(CN3[C@H](C)CN(C(=O)COC4CCC(Nc5ccc([N+](=O)[O-])c(C(F)(F)F)c5)CC4)C[C@@H]3C)ccc2c1 |
| InChI | InChI=1S/C33H39F3N4O4/c1-21-4-6-26-15-24(5-7-25(26)14-21)19-39-22(2)17-38(18-23(39)3)32(41)20-44-29-11-8-27(9-12-29)37-28-10-13-31(40(42)43)30(16-28)33(34,35)36/h4-7,10,13-16,22-23,27,29,37H,8-9,11-12,17-20H2,1-3H3/t22-,23+,27?,29? |
| InChIKey | JWTLLWIMCZWXJY-LSTNEIKWSA-N |
| XLogP | 6.94 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.69 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|