C12H10O5 — CID 90164671
(3E,3aR,6aR)-3-[(5-oxo-2H-furan-2-yl)oxymethylidene]-6,6a-dihydro-3aH-cyclopenta[b]furan-2-one (PubChem CID 90164671) has the molecular formula C12H10O5 and a molecular weight of 234.21 g/mol. Its IUPAC name is (3E,3aR,6aR)-3-[(5-oxo-2H-furan-2-yl)oxymethylidene]-6,6a-dihydro-3aH-cyclopenta[b]furan-2-one.
| Compound Name | (3E,3aR,6aR)-3-[(5-oxo-2H-furan-2-yl)oxymethylidene]-6,6a-dihydro-3aH-cyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 90164671 |
| Molecular Formula | C12H10O5 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | (3E,3aR,6aR)-3-[(5-oxo-2H-furan-2-yl)oxymethylidene]-6,6a-dihydro-3aH-cyclopenta[b]furan-2-one |
| SMILES | O=C1C=CC(O/C=C2/C(=O)O[C@@H]3CC=C[C@H]23)O1 |
| InChI | InChI=1S/C12H10O5/c13-10-4-5-11(17-10)15-6-8-7-2-1-3-9(7)16-12(8)14/h1-2,4-7,9,11H,3H2/b8-6+/t7-,9-,11?/m1/s1 |
| InChIKey | PTMZGNGAZQTXOM-OKVHKNPGSA-N |
| XLogP | 0.83 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|