C25H35NO4 — CID 90164696
[4-(1-adamantyl)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-8-yl] 2,2-dimethylbutanoate (PubChem CID 90164696) has the molecular formula C25H35NO4 and a molecular weight of 413.56 g/mol. Its IUPAC name is [4-(1-adamantyl)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-8-yl] 2,2-dimethylbutanoate.
| Compound Name | [4-(1-adamantyl)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-8-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 90164696 |
| Molecular Formula | C25H35NO4 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | [4-(1-adamantyl)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-8-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1CC2CC1C1C(=O)N(C34CC5CC(CC(C5)C3)C4)C(=O)C21 |
| InChI | InChI=1S/C25H35NO4/c1-4-24(2,3)23(29)30-18-9-16-8-17(18)20-19(16)21(27)26(22(20)28)25-10-13-5-14(11-25)7-15(6-13)12-25/h13-20H,4-12H2,1-3H3 |
| InChIKey | NHWVTMIDPFRDAS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|