C14H20O5 — CID 90164719
(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-2-benzofuran-5-yl) 2,2-dimethylbutanoate (PubChem CID 90164719) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is (1,3-dioxo-3a,4,5,6,7,7a-hexahydro-2-benzofuran-5-yl) 2,2-dimethylbutanoate.
| Compound Name | (1,3-dioxo-3a,4,5,6,7,7a-hexahydro-2-benzofuran-5-yl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 90164719 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | (1,3-dioxo-3a,4,5,6,7,7a-hexahydro-2-benzofuran-5-yl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1CCC2C(=O)OC(=O)C2C1 |
| InChI | InChI=1S/C14H20O5/c1-4-14(2,3)13(17)18-8-5-6-9-10(7-8)12(16)19-11(9)15/h8-10H,4-7H2,1-3H3 |
| InChIKey | ZLKPYZKNFWUXHX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|