C15H21NO4 — CID 90164720
(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-8-yl) 2,2-dimethylbutanoate (PubChem CID 90164720) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is (3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-8-yl) 2,2-dimethylbutanoate.
| Compound Name | (3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-8-yl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 90164720 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | (3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-8-yl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1CC2CC1C1C(=O)NC(=O)C21 |
| InChI | InChI=1S/C15H21NO4/c1-4-15(2,3)14(19)20-9-6-7-5-8(9)11-10(7)12(17)16-13(11)18/h7-11H,4-6H2,1-3H3,(H,16,17,18) |
| InChIKey | FSVVKWRNCMOAFB-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|