C41H32N2S2 — CID 90164787
9-ethyl-3-[5-(4-hexyl-5-pyridin-4-ylthiophen-2-yl)-4-octa-1,3,5,7-tetraynylthiophen-2-yl]carbazole (PubChem CID 90164787) has the molecular formula C41H32N2S2 and a molecular weight of 616.86 g/mol. Its IUPAC name is 9-ethyl-3-[5-(4-hexyl-5-pyridin-4-ylthiophen-2-yl)-4-octa-1,3,5,7-tetraynylthiophen-2-yl]carbazole.
| Compound Name | 9-ethyl-3-[5-(4-hexyl-5-pyridin-4-ylthiophen-2-yl)-4-octa-1,3,5,7-tetraynylthiophen-2-yl]carbazole |
|---|---|
| PubChem CID | 90164787 |
| Molecular Formula | C41H32N2S2 |
| Molecular Weight | 616.86 g/mol |
| Exact Mass | 616.20 |
| IUPAC Name | 9-ethyl-3-[5-(4-hexyl-5-pyridin-4-ylthiophen-2-yl)-4-octa-1,3,5,7-tetraynylthiophen-2-yl]carbazole |
| SMILES | C#CC#CC#CC#Cc1cc(-c2ccc3c(c2)c2ccccc2n3CC)sc1-c1cc(CCCCCC)c(-c2ccncc2)s1 |
| InChI | InChI=1S/C41H32N2S2/c1-4-7-9-11-12-14-18-33-28-38(31-21-22-37-35(27-31)34-19-15-16-20-36(34)43(37)6-3)44-41(33)39-29-32(17-13-10-8-5-2)40(45-39)30-23-25-42-26-24-30/h1,15-16,19-29H,5-6,8,10,13,17H2,2-3H3 |
| InChIKey | MLCJQBMRKPSSTO-UHFFFAOYSA-N |
| XLogP | 10.45 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.86 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|