About 1-(2-tert-butyl-4-methylphenyl)sulfonyl-2,2-dimethylpiperidine
1-(2-tert-butyl-4-methylphenyl)sulfonyl-2,2-dimethylpiperidine (PubChem CID 90164887) has the molecular formula C18H29NO2S
and a molecular weight of 323.50 g/mol. Its IUPAC name is 1-(2-tert-butyl-4-methylphenyl)sulfonyl-2,2-dimethylpiperidine.
Molecular Properties
| Compound Name | 1-(2-tert-butyl-4-methylphenyl)sulfonyl-2,2-dimethylpiperidine |
| PubChem CID | 90164887 |
| Molecular Formula | C18H29NO2S |
| Molecular Weight | 323.50 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 1-(2-tert-butyl-4-methylphenyl)sulfonyl-2,2-dimethylpiperidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCCC2(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H29NO2S/c1-14-9-10-16(15(13-14)17(2,3)4)22(20,21)19-12-8-7-11-18(19,5)6/h9-10,13H,7-8,11-12H2,1-6H3 |
| InChIKey | AHWLEKVENWNUCQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2-tert-butyl-4-methylphenyl)sulfonyl-2,2-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-tert-butyl-4-methylphenyl)sulfonyl-2,2-dimethylpiperidine?
The IUPAC name of 1-(2-tert-butyl-4-methylphenyl)sulfonyl-2,2-dimethylpiperidine (CID 90164887) is 1-(2-tert-butyl-4-methylphenyl)sulfonyl-2,2-dimethylpiperidine.
What is the SMILES notation for 1-(2-tert-butyl-4-methylphenyl)sulfonyl-2,2-dimethylpiperidine?
The canonical SMILES for 1-(2-tert-butyl-4-methylphenyl)sulfonyl-2,2-dimethylpiperidine is Cc1ccc(S(=O)(=O)N2CCCCC2(C)C)c(C(C)(C)C)c1.
What is the InChIKey of 1-(2-tert-butyl-4-methylphenyl)sulfonyl-2,2-dimethylpiperidine?
The InChIKey is AHWLEKVENWNUCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29NO2S/c1-14-9-10-16(15(13-14)17(2,3)4)22(20,21)19-12-8-7-11-18(19,5)6/h9-10,13H,7-8,11-12H2,1-6H3.
What are the key properties of 1-(2-tert-butyl-4-methylphenyl)sulfonyl-2,2-dimethylpiperidine?
1-(2-tert-butyl-4-methylphenyl)sulfonyl-2,2-dimethylpiperidine has a molecular weight of 323.50 g/mol, XLogP of 4.25, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-tert-butyl-4-methylphenyl)sulfonyl-2,2-dimethylpiperidine is sourced from PubChem (CID 90164887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).