C14H24BNO3 — CID 90165037
N-[(1R)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]acetamide (PubChem CID 90165037) has the molecular formula C14H24BNO3 and a molecular weight of 265.16 g/mol. Its IUPAC name is N-[(1R)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]acetamide.
| Compound Name | N-[(1R)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 90165037 |
| Molecular Formula | C14H24BNO3 |
| Molecular Weight | 265.16 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | N-[(1R)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]acetamide |
| SMILES | CC(=O)N[C@@H](C)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C14H24BNO3/c1-8(16-9(2)17)15-18-12-7-10-6-11(13(10,3)4)14(12,5)19-15/h8,10-12H,6-7H2,1-5H3,(H,16,17)/t8-,10-,11-,12+,14-/m0/s1 |
| InChIKey | DAFFEGWJVUIJFO-XVXKCHKCSA-N |
| XLogP | 1.78 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.16 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|