C20H32N6O6S3 — CID 90165536
1-methyl-3-[3-[3-[3-methyl-2,4,6-trioxo-5-(3-sulfanylpropyl)-1,3,5-triazinan-1-yl]propylsulfanyl]propyl]-5-(3-sulfanylpropyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 90165536) has the molecular formula C20H32N6O6S3 and a molecular weight of 548.71 g/mol. Its IUPAC name is 1-methyl-3-[3-[3-[3-methyl-2,4,6-trioxo-5-(3-sulfanylpropyl)-1,3,5-triazinan-1-yl]propylsulfanyl]propyl]-5-(3-sulfanylpropyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-methyl-3-[3-[3-[3-methyl-2,4,6-trioxo-5-(3-sulfanylpropyl)-1,3,5-triazinan-1-yl]propylsulfanyl]propyl]-5-(3-sulfanylpropyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 90165536 |
| Molecular Formula | C20H32N6O6S3 |
| Molecular Weight | 548.71 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | 1-methyl-3-[3-[3-[3-methyl-2,4,6-trioxo-5-(3-sulfanylpropyl)-1,3,5-triazinan-1-yl]propylsulfanyl]propyl]-5-(3-sulfanylpropyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | Cn1c(=O)n(CCCS)c(=O)n(CCCSCCCn2c(=O)n(C)c(=O)n(CCCS)c2=O)c1=O |
| InChI | InChI=1S/C20H32N6O6S3/c1-21-15(27)23(7-3-11-33)19(31)25(17(21)29)9-5-13-35-14-6-10-26-18(30)22(2)16(28)24(20(26)32)8-4-12-34/h33-34H,3-14H2,1-2H3 |
| InChIKey | JUEDEYIZAJFMDH-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 132.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.71 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|