C19H24FN5O2S — CID 90165599
N-[4-[(2-aminoethylsulfonimidoyl)methyl]-2-pyridinyl]-5-fluoro-4-[(3E)-3-methoxypenta-1,3-dien-2-yl]pyridin-2-amine (PubChem CID 90165599) has the molecular formula C19H24FN5O2S and a molecular weight of 405.50 g/mol. Its IUPAC name is N-[4-[(2-aminoethylsulfonimidoyl)methyl]-2-pyridinyl]-5-fluoro-4-[(3E)-3-methoxypenta-1,3-dien-2-yl]pyridin-2-amine.
| Compound Name | N-[4-[(2-aminoethylsulfonimidoyl)methyl]-2-pyridinyl]-5-fluoro-4-[(3E)-3-methoxypenta-1,3-dien-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 90165599 |
| Molecular Formula | C19H24FN5O2S |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | N-[4-[(2-aminoethylsulfonimidoyl)methyl]-2-pyridinyl]-5-fluoro-4-[(3E)-3-methoxypenta-1,3-dien-2-yl]pyridin-2-amine |
| SMILES | [H]N=S(=O)(CCN)Cc1ccnc(Nc2cc(C(=C)/C(=C\C)OC)c(F)cn2)c1 |
| InChI | InChI=1S/C19H24FN5O2S/c1-4-17(27-3)13(2)15-10-19(24-11-16(15)20)25-18-9-14(5-7-23-18)12-28(22,26)8-6-21/h4-5,7,9-11,22H,2,6,8,12,21H2,1,3H3,(H,23,24,25)/b17-4+ |
| InChIKey | ARQNBZAFSSMLGA-HAVNEIBRSA-N |
| XLogP | 3.43 |
| TPSA | 113.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|