C29H29F3N2O2 — CID 90165622
(4bS,7R,8aR)-4b-benzyl-7-hydroxy-N-(4-methyl-3-pyridinyl)-7-(trifluoromethyl)-5,6,8,8a,9,10-hexahydrophenanthrene-2-carboxamide (PubChem CID 90165622) has the molecular formula C29H29F3N2O2 and a molecular weight of 494.56 g/mol. Its IUPAC name is (4bS,7R,8aR)-4b-benzyl-7-hydroxy-N-(4-methyl-3-pyridinyl)-7-(trifluoromethyl)-5,6,8,8a,9,10-hexahydrophenanthrene-2-carboxamide.
| Compound Name | (4bS,7R,8aR)-4b-benzyl-7-hydroxy-N-(4-methyl-3-pyridinyl)-7-(trifluoromethyl)-5,6,8,8a,9,10-hexahydrophenanthrene-2-carboxamide |
|---|---|
| PubChem CID | 90165622 |
| Molecular Formula | C29H29F3N2O2 |
| Molecular Weight | 494.56 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | (4bS,7R,8aR)-4b-benzyl-7-hydroxy-N-(4-methyl-3-pyridinyl)-7-(trifluoromethyl)-5,6,8,8a,9,10-hexahydrophenanthrene-2-carboxamide |
| SMILES | Cc1ccncc1NC(=O)c1ccc2c(c1)CC[C@@H]1C[C@@](O)(C(F)(F)F)CC[C@@]21Cc1ccccc1 |
| InChI | InChI=1S/C29H29F3N2O2/c1-19-11-14-33-18-25(19)34-26(35)22-8-10-24-21(15-22)7-9-23-17-28(36,29(30,31)32)13-12-27(23,24)16-20-5-3-2-4-6-20/h2-6,8,10-11,14-15,18,23,36H,7,9,12-13,16-17H2,1H3,(H,34,35)/t23-,27+,28-/m1/s1 |
| InChIKey | PFBJOLPYJDUPPW-KEKPKEOLSA-N |
| XLogP | 6.16 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.56 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |