C24H23N7O3 — CID 90165839
3-[2-[2-[(4-morpholin-4-ylphenyl)diazenyl]pyrimidin-4-yl]-6,7-dihydro-4H-furo[3,2-c]pyridin-5-yl]-3-oxopropanenitrile (PubChem CID 90165839) has the molecular formula C24H23N7O3 and a molecular weight of 457.49 g/mol. Its IUPAC name is 3-[2-[2-[(4-morpholin-4-ylphenyl)diazenyl]pyrimidin-4-yl]-6,7-dihydro-4H-furo[3,2-c]pyridin-5-yl]-3-oxopropanenitrile.
| Compound Name | 3-[2-[2-[(4-morpholin-4-ylphenyl)diazenyl]pyrimidin-4-yl]-6,7-dihydro-4H-furo[3,2-c]pyridin-5-yl]-3-oxopropanenitrile |
|---|---|
| PubChem CID | 90165839 |
| Molecular Formula | C24H23N7O3 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 3-[2-[2-[(4-morpholin-4-ylphenyl)diazenyl]pyrimidin-4-yl]-6,7-dihydro-4H-furo[3,2-c]pyridin-5-yl]-3-oxopropanenitrile |
| SMILES | N#CCC(=O)N1CCc2oc(-c3ccnc(/N=N/c4ccc(N5CCOCC5)cc4)n3)cc2C1 |
| InChI | InChI=1S/C24H23N7O3/c25-8-5-23(32)31-10-7-21-17(16-31)15-22(34-21)20-6-9-26-24(27-20)29-28-18-1-3-19(4-2-18)30-11-13-33-14-12-30/h1-4,6,9,15H,5,7,10-14,16H2/b29-28+ |
| InChIKey | PWJGIORNGHJYRQ-ZQHSETAFSA-N |
| XLogP | 3.79 |
| TPSA | 120.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|