2-ethyl-2,4-dimethyl-4-(trifluoromethyl)hexanoic acid

C11H19F3O2 — CID 90165917

IUPAC2-ethyl-2,4-dimethyl-4-(trifluoromethyl)hexanoic acid
SMILESCCC(C)(CC(C)(CC)C(F)(F)F)C(=O)O
InChIInChI=1S/C11H19F3O2/c1-5-9(3,8(15)16)7-10(4,6-2)11(12,13)14/h5-7H2,1-4H3,(H,15,16)
InChIKeyQITVZAXOKUHELA-UHFFFAOYSA-N
MW240.26 g/mol
LogP3.86
Rot. Bonds5

About 2-ethyl-2,4-dimethyl-4-(trifluoromethyl)hexanoic acid

2-ethyl-2,4-dimethyl-4-(trifluoromethyl)hexanoic acid (PubChem CID 90165917) has the molecular formula C11H19F3O2 and a molecular weight of 240.26 g/mol. Its IUPAC name is 2-ethyl-2,4-dimethyl-4-(trifluoromethyl)hexanoic acid.

Molecular Properties

Compound Name2-ethyl-2,4-dimethyl-4-(trifluoromethyl)hexanoic acid
PubChem CID90165917
Molecular FormulaC11H19F3O2
Molecular Weight240.26 g/mol
Exact Mass240.13
IUPAC Name2-ethyl-2,4-dimethyl-4-(trifluoromethyl)hexanoic acid
SMILESCCC(C)(CC(C)(CC)C(F)(F)F)C(=O)O
InChIInChI=1S/C11H19F3O2/c1-5-9(3,8(15)16)7-10(4,6-2)11(12,13)14/h5-7H2,1-4H3,(H,15,16)
InChIKeyQITVZAXOKUHELA-UHFFFAOYSA-N
XLogP3.86
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.26
LogP ≤ 53.86
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-ethyl-2,4-dimethyl-4-(trifluoromethyl)hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethyl-2,4-dimethyl-4-(trifluoromethyl)hexanoic acid?
The IUPAC name of 2-ethyl-2,4-dimethyl-4-(trifluoromethyl)hexanoic acid (CID 90165917) is 2-ethyl-2,4-dimethyl-4-(trifluoromethyl)hexanoic acid.
What is the SMILES notation for 2-ethyl-2,4-dimethyl-4-(trifluoromethyl)hexanoic acid?
The canonical SMILES for 2-ethyl-2,4-dimethyl-4-(trifluoromethyl)hexanoic acid is CCC(C)(CC(C)(CC)C(F)(F)F)C(=O)O.
What is the InChIKey of 2-ethyl-2,4-dimethyl-4-(trifluoromethyl)hexanoic acid?
The InChIKey is QITVZAXOKUHELA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F3O2/c1-5-9(3,8(15)16)7-10(4,6-2)11(12,13)14/h5-7H2,1-4H3,(H,15,16).
What are the key properties of 2-ethyl-2,4-dimethyl-4-(trifluoromethyl)hexanoic acid?
2-ethyl-2,4-dimethyl-4-(trifluoromethyl)hexanoic acid has a molecular weight of 240.26 g/mol, XLogP of 3.86, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2,4-dimethyl-4-(trifluoromethyl)hexanoic acid is sourced from PubChem (CID 90165917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).