C10H20N2 — CID 90166388
1-[(Z)-[(Z)-2-ethylbut-2-enylidene]amino]-N,N-dimethylethanamine (PubChem CID 90166388) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is 1-[(Z)-[(Z)-2-ethylbut-2-enylidene]amino]-N,N-dimethylethanamine.
| Compound Name | 1-[(Z)-[(Z)-2-ethylbut-2-enylidene]amino]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 90166388 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 1-[(Z)-[(Z)-2-ethylbut-2-enylidene]amino]-N,N-dimethylethanamine |
| SMILES | C/C=C(\C=N/C(C)N(C)C)CC |
| InChI | InChI=1S/C10H20N2/c1-6-10(7-2)8-11-9(3)12(4)5/h6,8-9H,7H2,1-5H3/b10-6-,11-8- |
| InChIKey | APIWCJYMOMCOAE-XNFNPUBGSA-N |
| XLogP | 2.32 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|