C16H14F4N2O3 — CID 90167348
methyl 4-ethenyl-6-[(3Z,5E)-7-fluoro-5-(trifluoromethyl)hepta-1,3,5-trien-2-yl]oxypyrimidine-5-carboxylate (PubChem CID 90167348) has the molecular formula C16H14F4N2O3 and a molecular weight of 358.29 g/mol. Its IUPAC name is methyl 4-ethenyl-6-[(3Z,5E)-7-fluoro-5-(trifluoromethyl)hepta-1,3,5-trien-2-yl]oxypyrimidine-5-carboxylate.
| Compound Name | methyl 4-ethenyl-6-[(3Z,5E)-7-fluoro-5-(trifluoromethyl)hepta-1,3,5-trien-2-yl]oxypyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 90167348 |
| Molecular Formula | C16H14F4N2O3 |
| Molecular Weight | 358.29 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | methyl 4-ethenyl-6-[(3Z,5E)-7-fluoro-5-(trifluoromethyl)hepta-1,3,5-trien-2-yl]oxypyrimidine-5-carboxylate |
| SMILES | C=Cc1ncnc(OC(=C)/C=C\C(=C/CF)C(F)(F)F)c1C(=O)OC |
| InChI | InChI=1S/C16H14F4N2O3/c1-4-12-13(15(23)24-3)14(22-9-21-12)25-10(2)5-6-11(7-8-17)16(18,19)20/h4-7,9H,1-2,8H2,3H3/b6-5-,11-7+ |
| InChIKey | FIAMLCLSBOUUIX-GNLLZQBYSA-N |
| XLogP | 3.81 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.29 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|