C24H40O4 — CID 90168023
4-[[(1S,4aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-1-yl]methoxy]-4-oxobutanoic acid (PubChem CID 90168023) has the molecular formula C24H40O4 and a molecular weight of 392.58 g/mol. Its IUPAC name is 4-[[(1S,4aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-1-yl]methoxy]-4-oxobutanoic acid.
| Compound Name | 4-[[(1S,4aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-1-yl]methoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 90168023 |
| Molecular Formula | C24H40O4 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | 4-[[(1S,4aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-1-yl]methoxy]-4-oxobutanoic acid |
| SMILES | CC(C)C1CCC2C(CCC3[C@@](C)(COC(=O)CCC(=O)O)CCC[C@@]23C)C1 |
| InChI | InChI=1S/C24H40O4/c1-16(2)17-6-8-19-18(14-17)7-9-20-23(3,12-5-13-24(19,20)4)15-28-22(27)11-10-21(25)26/h16-20H,5-15H2,1-4H3,(H,25,26)/t17?,18?,19?,20?,23-,24+/m1/s1 |
| InChIKey | QBLIZLOGWXANCN-XPDGMTJRSA-N |
| XLogP | 5.69 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |