C17H25N7O3 — CID 90168720
tert-butyl (3S)-3-[(8-carbamoyl-9-ethylpurin-6-yl)amino]pyrrolidine-1-carboxylate (PubChem CID 90168720) has the molecular formula C17H25N7O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(8-carbamoyl-9-ethylpurin-6-yl)amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[(8-carbamoyl-9-ethylpurin-6-yl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 90168720 |
| Molecular Formula | C17H25N7O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | tert-butyl (3S)-3-[(8-carbamoyl-9-ethylpurin-6-yl)amino]pyrrolidine-1-carboxylate |
| SMILES | CCn1c(C(N)=O)nc2c(N[C@H]3CCN(C(=O)OC(C)(C)C)C3)ncnc21 |
| InChI | InChI=1S/C17H25N7O3/c1-5-24-14-11(22-15(24)12(18)25)13(19-9-20-14)21-10-6-7-23(8-10)16(26)27-17(2,3)4/h9-10H,5-8H2,1-4H3,(H2,18,25)(H,19,20,21)/t10-/m0/s1 |
| InChIKey | BMCICIRCNZLLLL-JTQLQIEISA-N |
| XLogP | 1.37 |
| TPSA | 128.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |