C19H28N8 — CID 90168751
8-(1-ethyl-5-methylpyrazol-4-yl)-9-methyl-N-[(3S)-1-propylpyrrolidin-3-yl]purin-6-amine (PubChem CID 90168751) has the molecular formula C19H28N8 and a molecular weight of 368.49 g/mol. Its IUPAC name is 8-(1-ethyl-5-methylpyrazol-4-yl)-9-methyl-N-[(3S)-1-propylpyrrolidin-3-yl]purin-6-amine.
| Compound Name | 8-(1-ethyl-5-methylpyrazol-4-yl)-9-methyl-N-[(3S)-1-propylpyrrolidin-3-yl]purin-6-amine |
|---|---|
| PubChem CID | 90168751 |
| Molecular Formula | C19H28N8 |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | 8-(1-ethyl-5-methylpyrazol-4-yl)-9-methyl-N-[(3S)-1-propylpyrrolidin-3-yl]purin-6-amine |
| SMILES | CCCN1CC[C@H](Nc2ncnc3c2nc(-c2cnn(CC)c2C)n3C)C1 |
| InChI | InChI=1S/C19H28N8/c1-5-8-26-9-7-14(11-26)23-17-16-19(21-12-20-17)25(4)18(24-16)15-10-22-27(6-2)13(15)3/h10,12,14H,5-9,11H2,1-4H3,(H,20,21,23)/t14-/m0/s1 |
| InChIKey | NPFRPNVUOVEAIU-AWEZNQCLSA-N |
| XLogP | 2.45 |
| TPSA | 76.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |