C20H26N8O — CID 90168943
1-[(3S)-3-[[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]amino]piperidin-1-yl]propan-1-one (PubChem CID 90168943) has the molecular formula C20H26N8O and a molecular weight of 394.48 g/mol. Its IUPAC name is 1-[(3S)-3-[[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]amino]piperidin-1-yl]propan-1-one.
| Compound Name | 1-[(3S)-3-[[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]amino]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 90168943 |
| Molecular Formula | C20H26N8O |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 1-[(3S)-3-[[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]amino]piperidin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCC[C@H](Nc2ncnc3c2nc(-c2cnc(C)nc2)n3CC)C1 |
| InChI | InChI=1S/C20H26N8O/c1-4-16(29)27-8-6-7-15(11-27)25-18-17-20(24-12-23-18)28(5-2)19(26-17)14-9-21-13(3)22-10-14/h9-10,12,15H,4-8,11H2,1-3H3,(H,23,24,25)/t15-/m0/s1 |
| InChIKey | QVBUTBAVPUKLBI-HNNXBMFYSA-N |
| XLogP | 2.42 |
| TPSA | 101.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |