C27H31BrN4O5 — CID 90169005
ethyl 6-[4-(5-bromopentanoylamino)phenyl]-1-(4-methoxycyclohexa-1,3-dien-1-yl)-7-oxo-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxylate (PubChem CID 90169005) has the molecular formula C27H31BrN4O5 and a molecular weight of 571.47 g/mol. Its IUPAC name is ethyl 6-[4-(5-bromopentanoylamino)phenyl]-1-(4-methoxycyclohexa-1,3-dien-1-yl)-7-oxo-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxylate.
| Compound Name | ethyl 6-[4-(5-bromopentanoylamino)phenyl]-1-(4-methoxycyclohexa-1,3-dien-1-yl)-7-oxo-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 90169005 |
| Molecular Formula | C27H31BrN4O5 |
| Molecular Weight | 571.47 g/mol |
| Exact Mass | 570.15 |
| IUPAC Name | ethyl 6-[4-(5-bromopentanoylamino)phenyl]-1-(4-methoxycyclohexa-1,3-dien-1-yl)-7-oxo-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1nn(C2=CC=C(OC)CC2)c2c1CCN(c1ccc(NC(=O)CCCCBr)cc1)C2=O |
| InChI | InChI=1S/C27H31BrN4O5/c1-3-37-27(35)24-22-15-17-31(19-9-7-18(8-10-19)29-23(33)6-4-5-16-28)26(34)25(22)32(30-24)20-11-13-21(36-2)14-12-20/h7-11,13H,3-6,12,14-17H2,1-2H3,(H,29,33) |
| InChIKey | UGCURFHNNPBDCJ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.47 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|