C27H28F3N7O — CID 90169207
1-[4-methyl-3-(1-methylpyrazol-4-yl)-1-phenylpyrazol-5-yl]-3-[3-(2,2,2-trifluoroethyl)-1,2,4,5-tetrahydro-3-benzazepin-5-yl]urea (PubChem CID 90169207) has the molecular formula C27H28F3N7O and a molecular weight of 523.56 g/mol. Its IUPAC name is 1-[4-methyl-3-(1-methylpyrazol-4-yl)-1-phenylpyrazol-5-yl]-3-[3-(2,2,2-trifluoroethyl)-1,2,4,5-tetrahydro-3-benzazepin-5-yl]urea.
| Compound Name | 1-[4-methyl-3-(1-methylpyrazol-4-yl)-1-phenylpyrazol-5-yl]-3-[3-(2,2,2-trifluoroethyl)-1,2,4,5-tetrahydro-3-benzazepin-5-yl]urea |
|---|---|
| PubChem CID | 90169207 |
| Molecular Formula | C27H28F3N7O |
| Molecular Weight | 523.56 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | 1-[4-methyl-3-(1-methylpyrazol-4-yl)-1-phenylpyrazol-5-yl]-3-[3-(2,2,2-trifluoroethyl)-1,2,4,5-tetrahydro-3-benzazepin-5-yl]urea |
| SMILES | Cc1c(-c2cnn(C)c2)nn(-c2ccccc2)c1NC(=O)NC1CN(CC(F)(F)F)CCc2ccccc21 |
| InChI | InChI=1S/C27H28F3N7O/c1-18-24(20-14-31-35(2)15-20)34-37(21-9-4-3-5-10-21)25(18)33-26(38)32-23-16-36(17-27(28,29)30)13-12-19-8-6-7-11-22(19)23/h3-11,14-15,23H,12-13,16-17H2,1-2H3,(H2,32,33,38) |
| InChIKey | OLGOUBARXHVBAU-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |