About 5-(4-methoxyphenyl)-2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidine
5-(4-methoxyphenyl)-2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidine (PubChem CID 901695) has the molecular formula C19H26N2O3
and a molecular weight of 330.43 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidine.
Molecular Properties
| Compound Name | 5-(4-methoxyphenyl)-2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidine |
| PubChem CID | 901695 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 5-(4-methoxyphenyl)-2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidine |
| SMILES | COc1ccc(-c2cnc(OC(C)(C)C)nc2OC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H26N2O3/c1-18(2,3)23-16-15(13-8-10-14(22-7)11-9-13)12-20-17(21-16)24-19(4,5)6/h8-12H,1-7H3 |
| InChIKey | VHYIADNSGBIZJU-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(4-methoxyphenyl)-2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methoxyphenyl)-2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidine?
The IUPAC name of 5-(4-methoxyphenyl)-2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidine (CID 901695) is 5-(4-methoxyphenyl)-2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidine.
What is the SMILES notation for 5-(4-methoxyphenyl)-2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidine?
The canonical SMILES for 5-(4-methoxyphenyl)-2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidine is COc1ccc(-c2cnc(OC(C)(C)C)nc2OC(C)(C)C)cc1.
What is the InChIKey of 5-(4-methoxyphenyl)-2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidine?
The InChIKey is VHYIADNSGBIZJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N2O3/c1-18(2,3)23-16-15(13-8-10-14(22-7)11-9-13)12-20-17(21-16)24-19(4,5)6/h8-12H,1-7H3.
What are the key properties of 5-(4-methoxyphenyl)-2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidine?
5-(4-methoxyphenyl)-2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidine has a molecular weight of 330.43 g/mol, XLogP of 4.51, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methoxyphenyl)-2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidine is sourced from PubChem (CID 901695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).