About 4-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]piperidine;hydrochloride
4-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]piperidine;hydrochloride (PubChem CID 90169798) has the molecular formula C14H16ClF2N3
and a molecular weight of 299.75 g/mol. Its IUPAC name is 4-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]piperidine;hydrochloride.
Molecular Properties
| Compound Name | 4-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]piperidine;hydrochloride |
| PubChem CID | 90169798 |
| Molecular Formula | C14H16ClF2N3 |
| Molecular Weight | 299.75 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 4-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]piperidine;hydrochloride |
| SMILES | Cl.Fc1ccc(-c2cnc(C3CCNCC3)[nH]2)c(F)c1 |
| InChI | InChI=1S/C14H15F2N3.ClH/c15-10-1-2-11(12(16)7-10)13-8-18-14(19-13)9-3-5-17-6-4-9;/h1-2,7-9,17H,3-6H2,(H,18,19);1H |
| InChIKey | NDEZFBWIZJGTJU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.75 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]piperidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]piperidine;hydrochloride?
The IUPAC name of 4-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]piperidine;hydrochloride (CID 90169798) is 4-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]piperidine;hydrochloride.
What is the SMILES notation for 4-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]piperidine;hydrochloride?
The canonical SMILES for 4-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]piperidine;hydrochloride is Cl.Fc1ccc(-c2cnc(C3CCNCC3)[nH]2)c(F)c1.
What is the InChIKey of 4-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]piperidine;hydrochloride?
The InChIKey is NDEZFBWIZJGTJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F2N3.ClH/c15-10-1-2-11(12(16)7-10)13-8-18-14(19-13)9-3-5-17-6-4-9;/h1-2,7-9,17H,3-6H2,(H,18,19);1H.
What are the key properties of 4-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]piperidine;hydrochloride?
4-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]piperidine;hydrochloride has a molecular weight of 299.75 g/mol, XLogP of 3.24, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]piperidine;hydrochloride is sourced from PubChem (CID 90169798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).