About 3,7-dimethyloct-6-enyl acetate
3,7-dimethyloct-6-enyl acetate (PubChem CID 9017) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is 3,7-dimethyloct-6-enyl acetate.
Molecular Properties
| Compound Name | 3,7-dimethyloct-6-enyl acetate |
| PubChem CID | 9017 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 3,7-dimethyloct-6-enyl acetate |
| SMILES | CC(=O)OCCC(C)CCC=C(C)C |
| InChI | InChI=1S/C12H22O2/c1-10(2)6-5-7-11(3)8-9-14-12(4)13/h6,11H,5,7-9H2,1-4H3 |
| InChIKey | JOZKFWLRHCDGJA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,7-dimethyloct-6-enyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethyloct-6-enyl acetate?
The IUPAC name of 3,7-dimethyloct-6-enyl acetate (CID 9017) is 3,7-dimethyloct-6-enyl acetate.
What is the SMILES notation for 3,7-dimethyloct-6-enyl acetate?
The canonical SMILES for 3,7-dimethyloct-6-enyl acetate is CC(=O)OCCC(C)CCC=C(C)C.
What is the InChIKey of 3,7-dimethyloct-6-enyl acetate?
The InChIKey is JOZKFWLRHCDGJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2/c1-10(2)6-5-7-11(3)8-9-14-12(4)13/h6,11H,5,7-9H2,1-4H3.
What are the key properties of 3,7-dimethyloct-6-enyl acetate?
3,7-dimethyloct-6-enyl acetate has a molecular weight of 198.31 g/mol, XLogP of 3.32, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethyloct-6-enyl acetate is sourced from PubChem (CID 9017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).