About diethoxy-hydroxy-[4-(2,4,5-trifluorophenyl)phenyl]silane
diethoxy-hydroxy-[4-(2,4,5-trifluorophenyl)phenyl]silane (PubChem CID 90170202) has the molecular formula C16H17F3O3Si
and a molecular weight of 342.39 g/mol. Its IUPAC name is diethoxy-hydroxy-[4-(2,4,5-trifluorophenyl)phenyl]silane.
Molecular Properties
| Compound Name | diethoxy-hydroxy-[4-(2,4,5-trifluorophenyl)phenyl]silane |
| PubChem CID | 90170202 |
| Molecular Formula | C16H17F3O3Si |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | diethoxy-hydroxy-[4-(2,4,5-trifluorophenyl)phenyl]silane |
| SMILES | CCO[Si](O)(OCC)c1ccc(-c2cc(F)c(F)cc2F)cc1 |
| InChI | InChI=1S/C16H17F3O3Si/c1-3-21-23(20,22-4-2)12-7-5-11(6-8-12)13-9-15(18)16(19)10-14(13)17/h5-10,20H,3-4H2,1-2H3 |
| InChIKey | QTKPPEPRVRDURB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze diethoxy-hydroxy-[4-(2,4,5-trifluorophenyl)phenyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxy-hydroxy-[4-(2,4,5-trifluorophenyl)phenyl]silane?
The IUPAC name of diethoxy-hydroxy-[4-(2,4,5-trifluorophenyl)phenyl]silane (CID 90170202) is diethoxy-hydroxy-[4-(2,4,5-trifluorophenyl)phenyl]silane.
What is the SMILES notation for diethoxy-hydroxy-[4-(2,4,5-trifluorophenyl)phenyl]silane?
The canonical SMILES for diethoxy-hydroxy-[4-(2,4,5-trifluorophenyl)phenyl]silane is CCO[Si](O)(OCC)c1ccc(-c2cc(F)c(F)cc2F)cc1.
What is the InChIKey of diethoxy-hydroxy-[4-(2,4,5-trifluorophenyl)phenyl]silane?
The InChIKey is QTKPPEPRVRDURB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17F3O3Si/c1-3-21-23(20,22-4-2)12-7-5-11(6-8-12)13-9-15(18)16(19)10-14(13)17/h5-10,20H,3-4H2,1-2H3.
What are the key properties of diethoxy-hydroxy-[4-(2,4,5-trifluorophenyl)phenyl]silane?
diethoxy-hydroxy-[4-(2,4,5-trifluorophenyl)phenyl]silane has a molecular weight of 342.39 g/mol, XLogP of 2.98, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxy-hydroxy-[4-(2,4,5-trifluorophenyl)phenyl]silane is sourced from PubChem (CID 90170202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).