C18H25F5OSi — CID 90170308
hydroxy-[4-(2,3,4,5,6-pentafluorophenyl)cyclohexyl]-di(propan-2-yl)silane (PubChem CID 90170308) has the molecular formula C18H25F5OSi and a molecular weight of 380.47 g/mol. Its IUPAC name is hydroxy-[4-(2,3,4,5,6-pentafluorophenyl)cyclohexyl]-di(propan-2-yl)silane.
| Compound Name | hydroxy-[4-(2,3,4,5,6-pentafluorophenyl)cyclohexyl]-di(propan-2-yl)silane |
|---|---|
| PubChem CID | 90170308 |
| Molecular Formula | C18H25F5OSi |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | hydroxy-[4-(2,3,4,5,6-pentafluorophenyl)cyclohexyl]-di(propan-2-yl)silane |
| SMILES | CC(C)[Si](O)(C(C)C)C1CCC(c2c(F)c(F)c(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C18H25F5OSi/c1-9(2)25(24,10(3)4)12-7-5-11(6-8-12)13-14(19)16(21)18(23)17(22)15(13)20/h9-12,24H,5-8H2,1-4H3 |
| InChIKey | ORIUIVGAQJUCRH-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|