About dihydroxy-methoxy-[6-(2,4,6-trifluorophenyl)hexyl]silane
dihydroxy-methoxy-[6-(2,4,6-trifluorophenyl)hexyl]silane (PubChem CID 90170374) has the molecular formula C13H19F3O3Si
and a molecular weight of 308.37 g/mol. Its IUPAC name is dihydroxy-methoxy-[6-(2,4,6-trifluorophenyl)hexyl]silane.
Molecular Properties
| Compound Name | dihydroxy-methoxy-[6-(2,4,6-trifluorophenyl)hexyl]silane |
| PubChem CID | 90170374 |
| Molecular Formula | C13H19F3O3Si |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | dihydroxy-methoxy-[6-(2,4,6-trifluorophenyl)hexyl]silane |
| SMILES | CO[Si](O)(O)CCCCCCc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C13H19F3O3Si/c1-19-20(17,18)7-5-3-2-4-6-11-12(15)8-10(14)9-13(11)16/h8-9,17-18H,2-7H2,1H3 |
| InChIKey | UJPVMJIVVRPWES-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy-methoxy-[6-(2,4,6-trifluorophenyl)hexyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy-methoxy-[6-(2,4,6-trifluorophenyl)hexyl]silane?
The IUPAC name of dihydroxy-methoxy-[6-(2,4,6-trifluorophenyl)hexyl]silane (CID 90170374) is dihydroxy-methoxy-[6-(2,4,6-trifluorophenyl)hexyl]silane.
What is the SMILES notation for dihydroxy-methoxy-[6-(2,4,6-trifluorophenyl)hexyl]silane?
The canonical SMILES for dihydroxy-methoxy-[6-(2,4,6-trifluorophenyl)hexyl]silane is CO[Si](O)(O)CCCCCCc1c(F)cc(F)cc1F.
What is the InChIKey of dihydroxy-methoxy-[6-(2,4,6-trifluorophenyl)hexyl]silane?
The InChIKey is UJPVMJIVVRPWES-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19F3O3Si/c1-19-20(17,18)7-5-3-2-4-6-11-12(15)8-10(14)9-13(11)16/h8-9,17-18H,2-7H2,1H3.
What are the key properties of dihydroxy-methoxy-[6-(2,4,6-trifluorophenyl)hexyl]silane?
dihydroxy-methoxy-[6-(2,4,6-trifluorophenyl)hexyl]silane has a molecular weight of 308.37 g/mol, XLogP of 2.78, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy-methoxy-[6-(2,4,6-trifluorophenyl)hexyl]silane is sourced from PubChem (CID 90170374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).