About [3,5-bis(trifluoromethyl)phenyl]methyl-triethoxysilane
[3,5-bis(trifluoromethyl)phenyl]methyl-triethoxysilane (PubChem CID 90170465) has the molecular formula C15H20F6O3Si
and a molecular weight of 390.40 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]methyl-triethoxysilane.
Molecular Properties
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]methyl-triethoxysilane |
| PubChem CID | 90170465 |
| Molecular Formula | C15H20F6O3Si |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]methyl-triethoxysilane |
| SMILES | CCO[Si](Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)(OCC)OCC |
| InChI | InChI=1S/C15H20F6O3Si/c1-4-22-25(23-5-2,24-6-3)10-11-7-12(14(16,17)18)9-13(8-11)15(19,20)21/h7-9H,4-6,10H2,1-3H3 |
| InChIKey | HFYZINKOHIGBOW-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [3,5-bis(trifluoromethyl)phenyl]methyl-triethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-bis(trifluoromethyl)phenyl]methyl-triethoxysilane?
The IUPAC name of [3,5-bis(trifluoromethyl)phenyl]methyl-triethoxysilane (CID 90170465) is [3,5-bis(trifluoromethyl)phenyl]methyl-triethoxysilane.
What is the SMILES notation for [3,5-bis(trifluoromethyl)phenyl]methyl-triethoxysilane?
The canonical SMILES for [3,5-bis(trifluoromethyl)phenyl]methyl-triethoxysilane is CCO[Si](Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)(OCC)OCC.
What is the InChIKey of [3,5-bis(trifluoromethyl)phenyl]methyl-triethoxysilane?
The InChIKey is HFYZINKOHIGBOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20F6O3Si/c1-4-22-25(23-5-2,24-6-3)10-11-7-12(14(16,17)18)9-13(8-11)15(19,20)21/h7-9H,4-6,10H2,1-3H3.
What are the key properties of [3,5-bis(trifluoromethyl)phenyl]methyl-triethoxysilane?
[3,5-bis(trifluoromethyl)phenyl]methyl-triethoxysilane has a molecular weight of 390.40 g/mol, XLogP of 4.85, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-bis(trifluoromethyl)phenyl]methyl-triethoxysilane is sourced from PubChem (CID 90170465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).