C13H18F4O3Si — CID 90171128
ethoxy-dimethoxy-[3-(2,3,4,5-tetrafluorophenyl)propyl]silane (PubChem CID 90171128) has the molecular formula C13H18F4O3Si and a molecular weight of 326.36 g/mol. Its IUPAC name is ethoxy-dimethoxy-[3-(2,3,4,5-tetrafluorophenyl)propyl]silane.
| Compound Name | ethoxy-dimethoxy-[3-(2,3,4,5-tetrafluorophenyl)propyl]silane |
|---|---|
| PubChem CID | 90171128 |
| Molecular Formula | C13H18F4O3Si |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | ethoxy-dimethoxy-[3-(2,3,4,5-tetrafluorophenyl)propyl]silane |
| SMILES | CCO[Si](CCCc1cc(F)c(F)c(F)c1F)(OC)OC |
| InChI | InChI=1S/C13H18F4O3Si/c1-4-20-21(18-2,19-3)7-5-6-9-8-10(14)12(16)13(17)11(9)15/h8H,4-7H2,1-3H3 |
| InChIKey | MYLVWMXJTYMKRL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|