C15H22F5NOSi — CID 90171944
N-[4-[diethyl(methoxy)silyl]butyl]-2,3,4,5,6-pentafluoroaniline (PubChem CID 90171944) has the molecular formula C15H22F5NOSi and a molecular weight of 355.42 g/mol. Its IUPAC name is N-[4-[diethyl(methoxy)silyl]butyl]-2,3,4,5,6-pentafluoroaniline.
| Compound Name | N-[4-[diethyl(methoxy)silyl]butyl]-2,3,4,5,6-pentafluoroaniline |
|---|---|
| PubChem CID | 90171944 |
| Molecular Formula | C15H22F5NOSi |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | N-[4-[diethyl(methoxy)silyl]butyl]-2,3,4,5,6-pentafluoroaniline |
| SMILES | CC[Si](CC)(CCCCNc1c(F)c(F)c(F)c(F)c1F)OC |
| InChI | InChI=1S/C15H22F5NOSi/c1-4-23(5-2,22-3)9-7-6-8-21-15-13(19)11(17)10(16)12(18)14(15)20/h21H,4-9H2,1-3H3 |
| InChIKey | HWOUGAVGFCPZOK-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|