About hydroxy-di(propan-2-yl)-(2,4,5-trifluorophenyl)silane
hydroxy-di(propan-2-yl)-(2,4,5-trifluorophenyl)silane (PubChem CID 90173314) has the molecular formula C12H17F3OSi
and a molecular weight of 262.35 g/mol. Its IUPAC name is hydroxy-di(propan-2-yl)-(2,4,5-trifluorophenyl)silane.
Molecular Properties
| Compound Name | hydroxy-di(propan-2-yl)-(2,4,5-trifluorophenyl)silane |
| PubChem CID | 90173314 |
| Molecular Formula | C12H17F3OSi |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | hydroxy-di(propan-2-yl)-(2,4,5-trifluorophenyl)silane |
| SMILES | CC(C)[Si](O)(c1cc(F)c(F)cc1F)C(C)C |
| InChI | InChI=1S/C12H17F3OSi/c1-7(2)17(16,8(3)4)12-6-10(14)9(13)5-11(12)15/h5-8,16H,1-4H3 |
| InChIKey | LFXMVFXZCVSTEQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze hydroxy-di(propan-2-yl)-(2,4,5-trifluorophenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-di(propan-2-yl)-(2,4,5-trifluorophenyl)silane?
The IUPAC name of hydroxy-di(propan-2-yl)-(2,4,5-trifluorophenyl)silane (CID 90173314) is hydroxy-di(propan-2-yl)-(2,4,5-trifluorophenyl)silane.
What is the SMILES notation for hydroxy-di(propan-2-yl)-(2,4,5-trifluorophenyl)silane?
The canonical SMILES for hydroxy-di(propan-2-yl)-(2,4,5-trifluorophenyl)silane is CC(C)[Si](O)(c1cc(F)c(F)cc1F)C(C)C.
What is the InChIKey of hydroxy-di(propan-2-yl)-(2,4,5-trifluorophenyl)silane?
The InChIKey is LFXMVFXZCVSTEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F3OSi/c1-7(2)17(16,8(3)4)12-6-10(14)9(13)5-11(12)15/h5-8,16H,1-4H3.
What are the key properties of hydroxy-di(propan-2-yl)-(2,4,5-trifluorophenyl)silane?
hydroxy-di(propan-2-yl)-(2,4,5-trifluorophenyl)silane has a molecular weight of 262.35 g/mol, XLogP of 3.07, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-di(propan-2-yl)-(2,4,5-trifluorophenyl)silane is sourced from PubChem (CID 90173314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).